![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | dr-juhi-aggarwal-professor-in-biochemistry.webp | 2025-08-20 12:03 | 19K | |
![[IMG]](/icons/image2.gif) | Dr. Gajra Bhagyashree Jayraj .webp | 2025-08-28 12:01 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Alif-Muzaffar-Sofi.webp | 2025-09-04 04:49 | 12K | |
![[IMG]](/icons/image2.gif) | Dr. Aakanksha Siwach SR Obs & Gynae.jpeg | 2025-09-04 04:49 | 83K | |
![[IMG]](/icons/image2.gif) | Dr. Vaishali Phogat .jpg | 2025-09-04 04:49 | 330K | |
![[IMG]](/icons/image2.gif) | Dr. Heena Senior Resident General Surgery.jpeg | 2025-09-04 04:49 | 98K | |
![[IMG]](/icons/image2.gif) | Dr. Nithya Dinesh SR Anaesthesiology.jpeg | 2025-09-10 04:05 | 109K | |
![[IMG]](/icons/image2.gif) | dr-parul-singla-assistant-professor-biochemistry.webp | 2025-09-10 04:05 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Ravi-Dutt-Wadhwa-Gynoecology.webp | 2025-09-10 06:29 | 16K | |
![[IMG]](/icons/image2.gif) | Dr .Ishaan dubey Tutor Pathology.jpeg | 2025-09-10 09:47 | 88K | |
![[IMG]](/icons/image2.gif) | Dr Abhishek Jawahar Kumar Tutor Pharmacology.jpeg | 2025-09-10 09:47 | 29K | |
![[IMG]](/icons/image2.gif) | Dr Ahibhushan SR Paediatrics.jpg | 2025-09-10 09:47 | 46K | |
![[IMG]](/icons/image2.gif) | Dr Anandhi Dhar, Assistant Professor, General Medicine.jpg | 2025-09-10 09:47 | 6.3M | |
![[IMG]](/icons/image2.gif) | Dr Anita Dubey, Assistant Professor, Ophathalmology.jpg | 2025-09-10 09:47 | 7.0M | |
![[IMG]](/icons/image2.gif) | Dr Kapil Sharma Tutor Community Medicine.jpeg | 2025-09-10 09:47 | 56K | |
![[IMG]](/icons/image2.gif) | Dr Karan Juneja .jpeg | 2025-09-10 09:47 | 20K | |
![[IMG]](/icons/image2.gif) | Dr Komal Tutor Community medicine.jpeg | 2025-09-10 09:47 | 59K | |
![[IMG]](/icons/image2.gif) | Dr Lakshya Bohra Tutor Community Medicine.jpeg | 2025-09-10 09:47 | 100K | |
![[IMG]](/icons/image2.gif) | Dr Neerav Saini, Assistant Professor, Pathology.webp | 2025-09-10 09:47 | 422K | |
![[IMG]](/icons/image2.gif) | Dr Nidhi Gupata, Assistant Professor, Community Medicine.webp | 2025-09-10 09:47 | 23K | |
![[IMG]](/icons/image2.gif) | Dr Nikki Sabarwal, Professor & HOD, Emergency Medicine.jpg | 2025-09-10 09:47 | 7.2M | |
![[IMG]](/icons/image2.gif) | Dr Nirmaljit Kaur Tutor Pathology.jpeg | 2025-09-10 09:47 | 142K | |
![[IMG]](/icons/image2.gif) | Dr Pawan Singh, Professor, Pathology.webp | 2025-09-10 09:47 | 760K | |
![[IMG]](/icons/image2.gif) | Dr Rekha Tutor Community Medicine.jpeg | 2025-09-10 09:47 | 53K | |
![[IMG]](/icons/image2.gif) | Dr Saksham Sharma, Assistant Professor, General Medicine.jpg | 2025-09-10 09:47 | 6.8M | |
![[IMG]](/icons/image2.gif) | Dr Shaurya Kumar Tutor Pharmacology.jpg | 2025-09-10 09:47 | 93K | |
![[IMG]](/icons/image2.gif) | Dr Taksh Ahuja Tutor Pharmacology.jpeg | 2025-09-10 09:47 | 49K | |
![[IMG]](/icons/image2.gif) | Dr Usha Sharma Tutor Pathology.jpeg | 2025-09-10 09:47 | 53K | |
![[IMG]](/icons/image2.gif) | Dr-AK-Singhal-Biochemistry.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Aastha-Anaesthesia.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Abhijeet-Ranjan.jpeg | 2025-09-10 09:47 | 32K | |
![[IMG]](/icons/image2.gif) | Dr-Abhishek-Gaurav-General-Medicine.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Ajay-Kumar-Anastesiology.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Akriti-Sharma-ent.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | Dr-Akriti-Sharma-ent_1.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr. Pratibha Senior Resident Obs & Gynae.jpeg | 2025-09-10 09:47 | 97K | |
![[IMG]](/icons/image2.gif) | Dr-Amit-Kumar-Pulmonary.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr-Amit-Kumar-Pulmonary_1.webp | 2025-09-10 09:47 | 8.3K | |
![[IMG]](/icons/image2.gif) | Dr-Angad-Jolly-Ortho.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Anil-Kumar-Medicine.webp | 2025-09-10 09:47 | 9.9K | |
![[IMG]](/icons/image2.gif) | Dr-Anita-Sharma-Pediatrics.webp | 2025-09-10 09:47 | 7.9K | |
![[IMG]](/icons/image2.gif) | Dr-Aparna-Agrawal-General-Medicine.jpg | 2025-09-10 09:47 | 32K | |
![[IMG]](/icons/image2.gif) | Dr-Arka-Mondal-Pharmacology.webp | 2025-09-10 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Dr-Aruj-Kumar-Khurana-Othem.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Arun-Kumar-Physiology.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Arun-Kumar-ent.webp | 2025-09-10 09:47 | 9.9K | |
![[IMG]](/icons/image2.gif) | Dr-Ashima-Singh-Microbiology.webp | 2025-09-10 09:47 | 5.1K | |
![[IMG]](/icons/image2.gif) | Dr-Ashok-Kumar-Khurana-Othm.webp | 2025-09-10 09:47 | 9.2K | |
![[IMG]](/icons/image2.gif) | Dr-Ashutosh-Tripathi-Psychiatry.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Ashwani-Saini-Psychiatry.webp | 2025-09-10 09:47 | 9.6K | |
![[IMG]](/icons/image2.gif) | Dr-Banashree-Das-Gynoecology.webp | 2025-09-10 09:47 | 9.3K | |
![[IMG]](/icons/image2.gif) | Dr-Bhawna-Piplani-Khurana-Othem.webp | 2025-09-10 09:47 | 8.6K | |
![[IMG]](/icons/image2.gif) | Dr-Bindoo-Yadav-Gynoecology.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Bishnupriya-Sahoo-Pediatrics.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Busi-Karunanand-Biochemistry.webp | 2025-09-10 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Dr-Deepti-Dwivedi-Physiology.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Dharampal-Singh-Sudan-Pulmonary.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | Dr-Dharmender-Orthopaedics.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Gagandeep-Kaur-Anatomy.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Gaurav-Arora.webp | 2025-09-10 09:47 | 9.4K | |
![[IMG]](/icons/image2.gif) | Dr-Gul-Motwani-ent.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr-Heenu-Dhar-Pharmacology.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Indu-Slathia-Pharmacology.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr-Jagbir-Singh-Malik-Comm-Medicine.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr-Jai-Mehar-Singh.jpg | 2025-09-10 09:47 | 23K | |
![[IMG]](/icons/image2.gif) | Dr-Jayati-Nath-Gynoecology.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Jeevan-Jyoti-Meena-Comm-Medicine.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Joginder-Pal-Chugh-Othem.webp | 2025-09-10 09:47 | 8.4K | |
![[IMG]](/icons/image2.gif) | Dr-Jyoti-Rani-FMT.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr-K-C-Khanduri-Anastesiology.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | Dr-Kanwar-Singh-Goel.webp | 2025-09-10 09:47 | 9.6K | |
![[IMG]](/icons/image2.gif) | Dr-Khushboo-Arora-ent.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Khushbu-Garg-Anastesiology.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Komal-Yadav-Pathology.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Kumar-Raju-RadioDiagnosis.jpg | 2025-09-10 09:47 | 18K | |
![[IMG]](/icons/image2.gif) | Dr-Leimapokpam-Sumitra-Devi-Microbiology.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-MD-Abu-Nasar-Gen-Surgery.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-MPS-Sawhney-Dermatology.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-MRIGANKO-SHEKHAR-RAY-Gen-Surgery.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Manav-Sethi.jpg | 2025-09-10 09:47 | 19K | |
![[IMG]](/icons/image2.gif) | Dr-Manisha-Khandait-Microbiology.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | Dr-Meenakshi-Arora-Physiology.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | Dr-Mona-Sidhu-Physiology.webp | 2025-09-10 09:47 | 9.3K | |
![[IMG]](/icons/image2.gif) | Dr-Monu-Sarin-Radio-Diagnosis.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Moumita-Sardar-Microbiology.webp | 2025-09-10 09:47 | 83K | |
![[IMG]](/icons/image2.gif) | Dr-Mukesh-Sharma-Microbiology.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Naina-Jain-Dermatology.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Narender-Kumar-Agarwal-FMT.webp | 2025-09-10 09:47 | 9.1K | |
![[IMG]](/icons/image2.gif) | Dr-Narinder-Kumar-Aggarwal.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Naveen-Chawla-Pathology.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Neeraj-Sharma-Othem.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Neeru-Kapur-Radio-Diagnosis.webp | 2025-09-10 09:47 | 9.2K | |
![[IMG]](/icons/image2.gif) | Dr-Nidhi-Bedi-Pediatrics.webp | 2025-09-10 09:47 | 9.8K | |
![[IMG]](/icons/image2.gif) | Dr-Nidhi-Gupta-Comm-Medicine.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Nidhi-Lal-Anatomy.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Nidhi-Lal-Anatomy_1.webp | 2025-09-10 09:47 | 30K | |
![[IMG]](/icons/image2.gif) | Dr-Nikhil-Payal-Microbiology.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Nimai-Chand-Chandra-Biochemistry.webp | 2025-09-10 09:47 | 23K | |
![[IMG]](/icons/image2.gif) | Dr-Nimarpreet-Kaur-Physiology.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Nitin-Rawal-Ortho.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Niyati-Sheokand.jpeg | 2025-09-10 09:47 | 29K | |
![[IMG]](/icons/image2.gif) | Dr-Pankaj-Abrol-Pediatrics.webp | 2025-09-10 09:47 | 9.6K | |
![[IMG]](/icons/image2.gif) | Dr-Parveen-Kumar-Antil-Pediatrics.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Parvinder-Chahar-Pharmacology.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Payal-Agarwal-Pediatrics.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Poonam-Salwan-Pharmacology.webp | 2025-09-10 09:47 | 17K | |
![[IMG]](/icons/image2.gif) | Dr-Poonam-Taneja-Gynoecology.webp | 2025-09-10 09:47 | 9.4K | |
![[IMG]](/icons/image2.gif) | Dr-Prachi-Saffar-Aneja-Anatomy.webp | 2025-09-10 09:47 | 7.7K | |
![[IMG]](/icons/image2.gif) | Dr-Pradeep-Kumar-Sharma-Psychiatry.webp | 2025-09-10 09:47 | 8.5K | |
![[IMG]](/icons/image2.gif) | Dr-Prafulla-Kumar-Sharma-Dermatology.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Pragyashaa-Chaudhary-Physiology.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr-Prem-Kumar-Singhal-Pulmonary.webp | 2025-09-10 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Dr-Priyamvada-Pediatrics.webp | 2025-09-10 09:47 | 9.5K | |
![[IMG]](/icons/image2.gif) | Dr-Priyanka-Gulia-Anastesiology.webp | 2025-09-10 09:47 | 9.9K | |
![[IMG]](/icons/image2.gif) | Dr-Rahul-Kadam-Gen-Surgery.webp | 2025-09-10 09:47 | 9.2K | |
![[IMG]](/icons/image2.gif) | Dr-Rajeev-Sen-Pathalogy.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | Dr-Rajesh-Arora-Radio-Diagnosis.webp | 2025-09-10 09:47 | 9.7K | |
![[IMG]](/icons/image2.gif) | Dr-Rajput-Chetan-Prakash-ortho.webp | 2025-09-10 09:47 | 9.6K | |
![[IMG]](/icons/image2.gif) | Dr-Ramendranath-Talukdar-Gen-Surgery.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Rashmi-Phogat-Microbiology.webp | 2025-09-10 09:47 | 9.5K | |
![[IMG]](/icons/image2.gif) | Dr-Rashmi-Ray-Gynoecology.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Richa-Pediatrics.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Rituparna-Saha-Microbiology.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Rodney-Preetham-Vaz.jpg | 2025-09-10 09:47 | 22K | |
![[IMG]](/icons/image2.gif) | Dr-Rohit-Sharma-Pathology.webp | 2025-09-10 09:47 | 8.9K | |
![[IMG]](/icons/image2.gif) | Dr-Roopali-Sehrawat-Pathology.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Sachet-Dawar-Pulmonary.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Sadhana-Meena-Gynoecology.webp | 2025-09-10 09:47 | 5.4K | |
![[IMG]](/icons/image2.gif) | Dr-Sahil-Choudhary-Paediatrics.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Saloni-Mahajan-Pathology.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Sangeeta-Narang-Comm-Medicine.webp | 2025-09-10 09:47 | 5.8K | |
![[IMG]](/icons/image2.gif) | Dr-Sanjeev-Kumar-Othem.webp | 2025-09-10 09:47 | 9.5K | |
![[IMG]](/icons/image2.gif) | Dr-Sanjiv-Kumar-Bansal.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Sansar-Chand-Sharma-Othem.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Saparya-Tripathi-Psychestry.webp | 2025-09-10 09:47 | 9.0K | |
![[IMG]](/icons/image2.gif) | Dr-Satya-Vir-Singh-Comm-Medicine.webp | 2025-09-10 09:47 | 8.5K | |
![[IMG]](/icons/image2.gif) | Dr-Savita-Saini-Anaste.webp | 2025-09-10 09:47 | 18K | |
![[IMG]](/icons/image2.gif) | Dr-Savita-Saini-Anastesiology.webp | 2025-09-10 09:47 | 19K | |
![[IMG]](/icons/image2.gif) | Dr-Shalinder-Koul-Gen-Surgery.webp | 2025-09-10 09:47 | 9.4K | |
![[IMG]](/icons/image2.gif) | Dr-Sheikh-Sajad-Ahmad-Gen-Surgery.webp | 2025-09-10 09:47 | 8.3K | |
![[IMG]](/icons/image2.gif) | Dr-Shibas-Chakarbati-Pulmonary.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Shikhar-Ganjoo-Dermatology.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Shilpi-Shloka-Biochemistry.webp | 2025-09-10 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Dr-Shivani-Rathee-Anastesiology.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Dr-Shivjeet-Yadav-General-Medicine.webp | 2025-09-10 09:47 | 109K | |
![[IMG]](/icons/image2.gif) | Dr-Shubham-Raghav.jpeg | 2025-09-10 09:47 | 30K | |
![[IMG]](/icons/image2.gif) | Dr-Sneha-Satya-Anastesiology.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr-Sumit-Tellewar.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Sunil-Arora-Pathology.webp | 2025-09-10 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Dr-Sunita-Vashist-Comm-Medicine.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Susmita-Saha-Anatomy.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Swati-Soni-Biochecmistry.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr-Tuhina-Gupta-Gynoecology.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr-Tulika-Gupta.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr-Utkarsh-khandewal.jpg | 2025-09-10 09:47 | 9.3M | |
![[IMG]](/icons/image2.gif) | Dr-Ved-Pal-Mahla-Psychiatry.webp | 2025-09-10 09:47 | 8.8K | |
![[IMG]](/icons/image2.gif) | Dr-Vibhash-Kumar-Anatomy.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr-Vijay-Kumar-Singhal-Comm-Medicine.webp | 2025-09-10 09:47 | 9.1K | |
![[IMG]](/icons/image2.gif) | Dr-Vikas-Kakkar-ent.webp | 2025-09-10 09:47 | 9.3K | |
![[IMG]](/icons/image2.gif) | Dr-Vipin-Jamdagni-Physiology.webp | 2025-09-10 09:47 | 9.9K | |
![[IMG]](/icons/image2.gif) | Dr-Vishnu-Datt-Anaesthesia.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr. Nashwa Shroff.webp | 2025-09-10 09:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | Dr. Sahaj Agrawal Senior Resident General Medicine.jpeg | 2025-09-10 09:47 | 108K | |
![[IMG]](/icons/image2.gif) | Dr. Aditya Rathee.jpeg | 2025-09-10 09:47 | 18K | |
![[IMG]](/icons/image2.gif) | Dr. Akanksha Assistanat Professor Department Of Microbiology.jpeg | 2025-09-10 09:47 | 87K | |
![[IMG]](/icons/image2.gif) | Dr. Akant Arora .jpg | 2025-09-10 09:47 | 279K | |
![[IMG]](/icons/image2.gif) | Dr. Akshita Maheshwari Senior Resident Obs & Gynae.jpeg | 2025-09-10 09:47 | 104K | |
![[IMG]](/icons/image2.gif) | Dr. Alisha Goyal .jpg | 2025-09-10 09:47 | 289K | |
![[IMG]](/icons/image2.gif) | Dr. Alisha Raj .webp | 2025-09-10 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Dr. Amita Saigal.webp | 2025-09-10 09:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | Dr. Amodini Kukreja Assistant Professor Anaesthesiology.jpeg | 2025-09-10 09:47 | 92K | |
![[IMG]](/icons/image2.gif) | Dr. Anam Singh.webp | 2025-09-10 09:47 | 5.0K | |
![[IMG]](/icons/image2.gif) | Dr. Anchal Rathi.webp | 2025-09-10 09:47 | 23K | |
![[IMG]](/icons/image2.gif) | Dr. Anibhushan Sonbhandra.jpeg | 2025-09-10 09:47 | 8.6K | |
![[IMG]](/icons/image2.gif) | Dr. Anil Kumar Pawah Professor General Medicine.jpeg | 2025-09-10 09:47 | 101K | |
![[IMG]](/icons/image2.gif) | Dr. Ankit Garg.jpeg | 2025-09-10 09:47 | 6.0K | |
![[IMG]](/icons/image2.gif) | Dr. Ankita Singh, Assistant Professor, Physiology.webp | 2025-09-10 09:47 | 864K | |
![[IMG]](/icons/image2.gif) | Dr. Anku Alisha.webp | 2025-09-10 09:47 | 5.0K | |
![[IMG]](/icons/image2.gif) | Dr. Anmol Gupta.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr. Anmoldeep Singh Sandhu Senior Resident Radio Diagnosis.webp | 2025-09-10 09:47 | 40K | |
![[IMG]](/icons/image2.gif) | Dr. Anup Kumar Chhabra.jpeg | 2025-09-10 09:47 | 6.3K | |
![[IMG]](/icons/image2.gif) | Dr. Archi Jain Senior Resident Radio Diagnosis.webp | 2025-09-10 09:47 | 61K | |
![[IMG]](/icons/image2.gif) | Dr. Arun Chauhan .webp | 2025-09-10 09:47 | 6.2K | |
![[IMG]](/icons/image2.gif) | Dr. Bharti Senior Resident Anaesthesiology.webp | 2025-09-10 09:47 | 54K | |
![[IMG]](/icons/image2.gif) | Dr. Bhavika Adlakha Senior Resident Ophthalmology.webp | 2025-09-10 09:47 | 63K | |
![[IMG]](/icons/image2.gif) | Dr. Bibek Bhurer Yadav.webp | 2025-09-10 09:47 | 19K | |
![[IMG]](/icons/image2.gif) | Dr. Bimal Thapa Senior Resident Orthopaedics.webp | 2025-09-10 09:47 | 26K | |
![[IMG]](/icons/image2.gif) | Dr. Calicut Muthukrishnan Sreedhar, Prof & HOD.jpg | 2025-09-10 09:47 | 8.6M | |
![[IMG]](/icons/image2.gif) | Dr. Charu Verma.webp | 2025-09-10 09:47 | 21K | |
![[IMG]](/icons/image2.gif) | Dr. Debopam Das Senior Resident Psychiatry.jpeg | 2025-09-10 09:47 | 57K | |
![[IMG]](/icons/image2.gif) | Dr. Deepanshi Saxena Assistant Professor Comm. Medicine.jpeg | 2025-09-10 09:47 | 79K | |
![[IMG]](/icons/image2.gif) | Dr. Deepika Singh.webp | 2025-09-10 09:47 | 8.6K | |
![[IMG]](/icons/image2.gif) | Dr. Dheeraj Bahl Dean & Professor Of Paediatrics.jpg | 2025-09-10 09:47 | 6.2M | |
![[IMG]](/icons/image2.gif) | Dr. Dheeraj Bahl, Professor & Dean, Paediatrics.jpg | 2025-09-10 09:47 | 6.2M | |
![[IMG]](/icons/image2.gif) | Dr. Diksha Dutt.webp | 2025-09-10 09:47 | 8.3K | |
![[IMG]](/icons/image2.gif) | Dr. Dinesh Kumar Tiwari.jpeg | 2025-09-10 09:47 | 5.6K | |
![[IMG]](/icons/image2.gif) | Dr. Dipak Mishra Senior Resident General Surgery.webp | 2025-09-10 09:47 | 42K | |
![[IMG]](/icons/image2.gif) | Dr. Dipti Charisma Ekka Assistant Professor Biochemistry.jpeg | 2025-09-10 09:47 | 77K | |
![[IMG]](/icons/image2.gif) | Dr. Donepudi Aswini SR Paediatrics 2.jpeg | 2025-09-10 09:47 | 67K | |
![[IMG]](/icons/image2.gif) | Dr. Drishti Sachan Tutor Pathology.jpeg | 2025-09-10 09:47 | 23K | |
![[IMG]](/icons/image2.gif) | Dr. Ela Kinra.webp | 2025-09-10 09:47 | 19K | |
![[IMG]](/icons/image2.gif) | Dr. Garima Yadav Assistant Professor Paediatrics.jpg | 2025-09-10 09:47 | 9.6M | |
![[IMG]](/icons/image2.gif) | Dr. Garima Yadav, Assistant Professor, paediatrics.jpg | 2025-09-10 09:47 | 9.6M | |
![[IMG]](/icons/image2.gif) | Dr. Garima Yadav-1.jpg | 2025-09-10 09:47 | 9.6M | |
![[IMG]](/icons/image2.gif) | Dr. Gaurav Tutor FMT.jpeg | 2025-09-10 09:47 | 149K | |
![[IMG]](/icons/image2.gif) | Dr. Gautam Tutor Microbiology.jpeg | 2025-09-10 09:47 | 19K | |
![[IMG]](/icons/image2.gif) | Dr. Geetika Singh Associate Professor, Community Medicine.webp | 2025-09-10 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Dr. Gunjan Gahlot .jpg | 2025-09-10 09:47 | 299K | |
![[IMG]](/icons/image2.gif) | Dr. Gunjan Jangid .jpg | 2025-09-10 09:47 | 518K | |
![[IMG]](/icons/image2.gif) | Dr. Haristha I.jpg | 2025-09-10 09:47 | 422K | |
![[IMG]](/icons/image2.gif) | Dr. Harsh Punia.webp | 2025-09-10 09:47 | 8.9K | |
![[IMG]](/icons/image2.gif) | Dr. Harshal S Aswar.jpeg | 2025-09-10 09:47 | 5.5K | |
![[IMG]](/icons/image2.gif) | Dr. Harshit Sharma Tutor Pathology.jpeg | 2025-09-10 09:47 | 124K | |
![[IMG]](/icons/image2.gif) | Dr. Harvinder SR Opthalmology.jpeg | 2025-09-10 09:47 | 55K | |
![[IMG]](/icons/image2.gif) | Dr. Hema Kapoor.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr. ISHIKA.webp | 2025-09-10 09:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | Dr. Ina Agarwal Senior Resident Dermatology.webp | 2025-09-10 09:47 | 27K | |
![[IMG]](/icons/image2.gif) | Dr. Jasmine.webp | 2025-09-10 09:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | Dr. Jeevan Jyoti Meena .webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr. Kamal Singla Associate Professor FMT.jpeg | 2025-09-10 09:47 | 54K | |
![[IMG]](/icons/image2.gif) | Dr. Kamna Kakkar Assistant Professor Anaesthesia.jpeg | 2025-09-10 09:47 | 191K | |
![[IMG]](/icons/image2.gif) | Dr. Kiran.webp | 2025-09-10 09:47 | 26K | |
![[IMG]](/icons/image2.gif) | Dr. Komal Assistant Professor General Medicine.jpeg | 2025-09-10 09:47 | 108K | |
![[IMG]](/icons/image2.gif) | Dr. Kshitij Garg Assistant Professor Community Medicine.jpeg | 2025-09-10 09:47 | 108K | |
![[IMG]](/icons/image2.gif) | Dr. Lalit Yadav Senior Resident Radio Diagnosis.webp | 2025-09-10 09:47 | 21K | |
![[IMG]](/icons/image2.gif) | Dr. Maha Singh Profesor Paediatrics.jpeg | 2025-09-10 09:47 | 121K | |
![[IMG]](/icons/image2.gif) | Dr. Mahipal Singh Sidhu.jpeg | 2025-09-10 09:47 | 42K | |
![[IMG]](/icons/image2.gif) | Dr. Manish Dahiya.webp | 2025-09-10 09:47 | 3.8K | |
![[IMG]](/icons/image2.gif) | Dr. Manoj Yadav.webp | 2025-09-10 09:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | Dr. Manpreet Kaur Bajwa .jpeg | 2025-09-10 09:47 | 51K | |
![[IMG]](/icons/image2.gif) | Dr. Mansi Sheoran.jpeg | 2025-09-10 09:47 | 49K | |
![[IMG]](/icons/image2.gif) | Dr. Mohit Kumar Narwal Senior Resident General Medicine.jpeg | 2025-09-10 09:47 | 89K | |
![[IMG]](/icons/image2.gif) | Dr. Monarika.webp | 2025-09-10 09:47 | 3.4K | |
![[IMG]](/icons/image2.gif) | Dr. Monu.jpeg | 2025-09-10 09:47 | 5.5K | |
![[IMG]](/icons/image2.gif) | Dr. Nalin Chugh.jpeg | 2025-09-10 09:47 | 6.6K | |
![[IMG]](/icons/image2.gif) | Dr. Nandini Sharma .webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr. Navdeep Malik .jpg | 2025-09-10 09:47 | 307K | |
![[IMG]](/icons/image2.gif) | Dr. Neehal Zuturu Senior Resident ENT.jpeg | 2025-09-10 09:47 | 52K | |
![[IMG]](/icons/image2.gif) | Dr. Nikhil Chahal.webp | 2025-09-10 09:47 | 7.8K | |
![[IMG]](/icons/image2.gif) | Dr. Nikhil Jain .webp | 2025-09-10 09:47 | 8.9K | |
![[IMG]](/icons/image2.gif) | Dr. Nishant.webp | 2025-09-10 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Dr. Nitisha Goyal.jpeg | 2025-09-10 09:47 | 9.1K | |
![[IMG]](/icons/image2.gif) | Dr. Nivedita.webp | 2025-09-10 09:47 | 2.5K | |
![[IMG]](/icons/image2.gif) | Dr. Okram Sheetle.webp | 2025-09-10 09:47 | 99K | |
![[IMG]](/icons/image2.gif) | Dr. Parkash Singh Khatana Professor Department Of General Surgery.jpeg | 2025-09-10 09:47 | 49K | |
![[IMG]](/icons/image2.gif) | Dr. Payal Mehra Assistant Professor Pathology.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr. Pooja Yadav.webp | 2025-09-10 09:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | Dr. Prachy Garg Senior Resident Dermatology.jpeg | 2025-09-10 09:47 | 92K | |
![[IMG]](/icons/image2.gif) | Dr. Prem Kumar, Assistant Professor, Orthopaedics.jpg | 2025-09-10 09:47 | 6.7M | |
![[IMG]](/icons/image2.gif) | Dr. Priyanka Assistant Professor Emergency Medicine.jpeg | 2025-09-10 09:47 | 69K | |
![[IMG]](/icons/image2.gif) | Dr. Priyanka Gupta, Associate Professor, Community Medicine.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr. Priyanka, Assistant Professor, Obstetrics & Gynaecology.jpg | 2025-09-10 09:47 | 6.3M | |
![[IMG]](/icons/image2.gif) | Dr. Puja Aggarwal.webp | 2025-09-10 09:47 | 2.8K | |
![[IMG]](/icons/image2.gif) | Dr. Purva Tutor FMT.jpeg | 2025-09-10 09:47 | 111K | |
![[IMG]](/icons/image2.gif) | Dr. Raja Ram Aggarwal.jpeg | 2025-09-10 09:47 | 6.3K | |
![[IMG]](/icons/image2.gif) | Dr. Rakesh Anjna .webp | 2025-09-10 09:47 | 29K | |
![[IMG]](/icons/image2.gif) | Dr. Raman Sethi.webp | 2025-09-10 09:47 | 9.4K | |
![[IMG]](/icons/image2.gif) | Dr. Rashmi Gupta.jpeg | 2025-09-10 09:47 | 8.9K | |
![[IMG]](/icons/image2.gif) | Dr. Revin .jpg | 2025-09-10 09:47 | 281K | |
![[IMG]](/icons/image2.gif) | Dr. Rohit Tanwar, Assistant Professor (1).jpeg | 2025-09-10 09:47 | 5.9K | |
![[IMG]](/icons/image2.gif) | Dr. Ruchi .jpg | 2025-09-10 09:47 | 364K | |
![[IMG]](/icons/image2.gif) | Dr. Ruchika Arya .jpg | 2025-09-10 09:47 | 246K | |
![[IMG]](/icons/image2.gif) | Dr. Rupali Kashyap.jpg | 2025-09-10 09:47 | 238K | |
![[IMG]](/icons/image2.gif) | Dr. Sachin Kalyan.webp | 2025-09-10 09:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | Dr. Sagar Garg SR Radio Diagnosis.jpeg | 2025-09-10 09:47 | 5.4K | |
![[IMG]](/icons/image2.gif) | Dr. Sahil Chaudhary Assistant Professor Paediatrics Department.jpg | 2025-09-10 09:47 | 9.4M | |
![[IMG]](/icons/image2.gif) | Dr. Sandeep AP FMT.jpeg | 2025-09-10 09:47 | 86K | |
![[IMG]](/icons/image2.gif) | Dr. Sandeep Nain .jpg | 2025-09-10 09:47 | 260K | |
![[IMG]](/icons/image2.gif) | Dr. Sandhya Gupta.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | Dr. Satya Prakash Yadav, Associate Professor, General Medicine.jpg | 2025-09-10 09:47 | 8.9M | |
![[IMG]](/icons/image2.gif) | Dr. Saumay Batra .jpg | 2025-09-10 09:47 | 382K | |
![[IMG]](/icons/image2.gif) | Dr. Saurabh Sharma.webp | 2025-09-10 09:47 | 9.8K | |
![[IMG]](/icons/image2.gif) | Dr. Shefali.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr. Shilpa.webp | 2025-09-10 09:47 | 23K | |
![[IMG]](/icons/image2.gif) | Dr. Shivam Rampal .jpg | 2025-09-10 09:47 | 366K | |
![[IMG]](/icons/image2.gif) | Dr. Shobhita Gupta .webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr. Shreya Dargan Senior Resident Radio Diagnosis.webp | 2025-09-10 09:47 | 40K | |
![[IMG]](/icons/image2.gif) | Dr. Shrishti Shrivastava.jpeg | 2025-09-10 09:47 | 21K | |
![[IMG]](/icons/image2.gif) | Dr. Shruthi Sagar Borker.webp | 2025-09-10 09:47 | 17K | |
![[IMG]](/icons/image2.gif) | Dr. Shryash Yadav.PNG | 2025-09-10 09:47 | 44K | |
![[IMG]](/icons/image2.gif) | Dr. Smriti Pandey.jpeg | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Dr. Suchitra Solanki.webp | 2025-09-10 09:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | Dr. Tanika.webp | 2025-09-10 09:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | Dr. Tanvi Ghate Assistant Professor Radio Diagnosis.webp | 2025-09-10 09:47 | 36K | |
![[IMG]](/icons/image2.gif) | Dr. Tapan Aggarwal.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr. Tarun Jhamb.jpeg | 2025-09-10 09:47 | 5.8K | |
![[IMG]](/icons/image2.gif) | Dr. Urvashi Yadav.webp | 2025-09-10 09:47 | 7.4K | |
![[IMG]](/icons/image2.gif) | Dr. Vageesha Singh Tutor Pharmacology 1.jpeg | 2025-09-10 09:47 | 58K | |
![[IMG]](/icons/image2.gif) | Dr. Srikar Yedlapalli Assistant Professor Obs & Gynae.jpeg | 2025-09-10 09:47 | 89K | |
![[IMG]](/icons/image2.gif) | Dr. Varun Gosain.jpeg | 2025-09-10 09:47 | 9.3K | |
![[IMG]](/icons/image2.gif) | Dr. Varuna Sharma Senior Resident General Medicine.webp | 2025-09-10 09:47 | 57K | |
![[IMG]](/icons/image2.gif) | Dr. Vibha Vasudeva.webp | 2025-09-10 09:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | Dr. Vikas Siwach.webp | 2025-09-10 09:47 | 8.2K | |
![[IMG]](/icons/image2.gif) | Dr. Vikas Yadav .jpg | 2025-09-10 09:47 | 289K | |
![[IMG]](/icons/image2.gif) | Dr. Vishal Subhash.jpeg | 2025-09-10 09:47 | 9.3K | |
![[IMG]](/icons/image2.gif) | Dr. Vishnu Vaish.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Dr. Yogesh Kumar, Assistant Professor Radiology.jpg | 2025-09-10 09:47 | 10M | |
![[IMG]](/icons/image2.gif) | Dr. Zenith, Assistant Professor, Dermatology.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | Dr.(Brig) Sadhan Sawhney Professor In Anaesthesiology Department.jpeg | 2025-09-10 09:47 | 44K | |
![[IMG]](/icons/image2.gif) | Dr.JANHVI HOODA.webp | 2025-09-10 09:47 | 603K | |
![[IMG]](/icons/image2.gif) | Dr.RUBY RANI.webp | 2025-09-10 09:47 | 1.0M | |
![[IMG]](/icons/image2.gif) | Dr.Ruchika Yadav.webp | 2025-09-10 09:47 | 19K | |
![[IMG]](/icons/image2.gif) | Dr.Subham Goyal.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | Dr.TOMBOO .webp | 2025-09-10 09:47 | 107K | |
![[IMG]](/icons/image2.gif) | Mr-Sunil-Kumar-Chamola-Comm-Medicine.webp | 2025-09-10 09:47 | 9.5K | |
![[IMG]](/icons/image2.gif) | Mr. Paramveer Tutor in Anatomy Department.jpeg | 2025-09-10 09:47 | 73K | |
![[IMG]](/icons/image2.gif) | Mr. Pradhumn Katara .webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | Ms-Hina-Arya.jpg | 2025-09-10 09:47 | 24K | |
![[IMG]](/icons/image2.gif) | Ms-Prasad-Pushpa-Umesh-Physiology.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | Ms. Akanksha.webp | 2025-09-10 09:47 | 17K | |
![[IMG]](/icons/image2.gif) | Ms. Ankita Kumari Soni.webp | 2025-09-10 09:47 | 24K | |
![[IMG]](/icons/image2.gif) | Ms. Neha Singla Tutor Cum Statistician Community Medicine Department.jpeg | 2025-09-10 09:47 | 73K | |
![[IMG]](/icons/image2.gif) | Ms. Yamini Verma.webp | 2025-09-10 09:47 | 18K | |
![[IMG]](/icons/image2.gif) | Prof-Surinder-Pal-Singh-Kochar-Gynoecology.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | dr-aakriti-sood-senior-resident-psychiatry.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | dr-aditi-agrawal-senior-resident-obs-gynae.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | dr-amit-senior-resident-general-medicine.webp | 2025-09-10 09:47 | 18K | |
![[IMG]](/icons/image2.gif) | dr-amita-saigal-associate-professor.webp | 2025-09-10 09:47 | 8.7K | |
![[IMG]](/icons/image2.gif) | dr-anita-nangia-professor-in-pathology.webp | 2025-09-10 09:47 | 18K | |
![[IMG]](/icons/image2.gif) | dr-anjali-nadir-bhat-professor-in-physiology.webp | 2025-09-10 09:47 | 17K | |
![[IMG]](/icons/image2.gif) | dr-ashok-kumar-hooda-professor-in-general-medicine.webp | 2025-09-10 09:47 | 31K | |
![[IMG]](/icons/image2.gif) | dr-dipankar-naskar-associate-professor-general-surgery.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | dr-jasdeep-monga-professor-in-ent.webp | 2025-09-10 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | dr-mamta-malik-assistant-professor-in-paediatrics.webp | 2025-09-10 09:47 | 8.0K | |
![[IMG]](/icons/image2.gif) | dr-manish-singh-ahuja-professor-in-anatomy.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | dr-manjit-tanwar-associate-professor-general-surgery.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | dr-manju-puri-senior-professor-obs-gynae.webp | 2025-09-10 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | dr-mansha-grover-senior-resident-in-pulmonary-medicine.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | dr-mohit-kumar-sr-radio-diagnosis.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | dr-monika-dalal-choudhary-senior-resident-anaesthesiology.webp | 2025-09-10 09:47 | 17K | |
![[IMG]](/icons/image2.gif) | dr-naudibya-majhi-assistant-professor-in-community-medicine.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | dr-naveen-kumar-singh-assistant-professor-biochemistry.webp | 2025-09-10 09:47 | 8.9K | |
![[IMG]](/icons/image2.gif) | dr-neha-chauhan-senior-resident-biochemistry.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | dr-nikhil-arora-senior-resident-paediatrics.webp | 2025-09-10 09:47 | 8.6K | |
![[IMG]](/icons/image2.gif) | dr-pawan-yadav-assistant-professor-general-surgery.webp | 2025-09-10 09:47 | 9.8K | |
![[IMG]](/icons/image2.gif) | dr-puneet-kamra-assistant-professor-orthopaedics.webp | 2025-09-10 09:47 | 341K | |
![[IMG]](/icons/image2.gif) | dr-rachna-gulati-associate-professor-in-pathology.webp | 2025-09-10 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | dr-radha-mathur-senior-resident-in-opthalmology.webp | 2025-09-10 09:47 | 38K | |
![[IMG]](/icons/image2.gif) | dr-rahul-singh-senior-resident-ent.webp | 2025-09-10 09:47 | 25K | |
![[IMG]](/icons/image2.gif) | dr-rahul-yadav-assistant-professor-general-surgery.webp | 2025-09-10 09:47 | 8.9K | |
![[IMG]](/icons/image2.gif) | dr-rahul-yadav-assistant-professor-orthopaedics.webp | 2025-09-10 09:47 | 304K | |
![[IMG]](/icons/image2.gif) | dr-raval-jaimine-senior-resident-general-medicine.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | dr-rishabh-bansal-senior-resident-radio-diagnosis.webp | 2025-09-10 09:47 | 19K | |
![[IMG]](/icons/image2.gif) | dr-sakshi-gupta-sr-obs-gynae.webp | 2025-09-10 09:47 | 16K | |
![[IMG]](/icons/image2.gif) | dr-sandhya-gupta-associate-professor-general-surgery.webp | 2025-09-10 09:47 | 2.5K | |
![[IMG]](/icons/image2.gif) | dr-satya-prakash-yadav-associate-professor-general-medicine.webp | 2025-09-10 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | dr-shweta-verma-assistant-professor-in-general-surgery.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | dr-sneha-sharma-associate-professor-orthopaedics.webp | 2025-09-10 09:47 | 9.1K | |
![[IMG]](/icons/image2.gif) | dr-snehil.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | dr-sunil-kumar-assistant-professor-general-surgery.webp | 2025-09-10 09:47 | 339K | |
![[IMG]](/icons/image2.gif) | dr-tanushree-kumar-assistant-professor-pharmacology.webp | 2025-09-10 09:47 | 9.2K | |
![[IMG]](/icons/image2.gif) | dr-tarun-gupta-assistant-professor-general-surgey.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | dr-tarun-jhamb-assistant-professor-general-medicine.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | dr-vani-mittal-sr-pathology.webp | 2025-09-10 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | drramesh-singh-pal-associate-professor-pulmonary-medicine.webp | 2025-09-10 09:47 | 9.8K | |
![[IMG]](/icons/image2.gif) | female-icon.webp | 2025-09-10 09:47 | 4.6K | |
![[IMG]](/icons/image2.gif) | jyoti-yadav-medical.JPG | 2025-09-10 09:47 | 18K | |
![[IMG]](/icons/image2.gif) | male-icon.webp | 2025-09-10 09:47 | 4.9K | |
![[IMG]](/icons/image2.gif) | ms-meena-tutor-physiology.webp | 2025-09-10 09:47 | 9.0K | |
![[IMG]](/icons/image2.gif) | priya-kataria.jpeg | 2025-09-10 09:47 | 90K | |
![[IMG]](/icons/image2.gif) | Dr. Swikriti Raniwala Senior Resident General Surgery.jpeg | 2025-09-10 09:47 | 84K | |
![[IMG]](/icons/image2.gif) | Dr. Aditya Mehta Senior Resident Orthopaedics.jpeg | 2025-09-10 09:47 | 65K | |
![[IMG]](/icons/image2.gif) | Dr. Apoorva Mathur Senior Resident Pathology.jpeg | 2025-09-10 09:47 | 65K | |
![[IMG]](/icons/image2.gif) | Dr. Arik Dua Senior Resident General Medicine.jpeg | 2025-09-10 09:47 | 86K | |
![[IMG]](/icons/image2.gif) | Dr. Ashish Chauhan Assistant Professor Emergency Medicine.jpeg | 2025-09-10 09:47 | 88K | |
![[IMG]](/icons/image2.gif) | Dr. Chetna Mishra Assistant Professor Radio Diagnosis.jpeg | 2025-09-10 09:47 | 314K | |
![[IMG]](/icons/image2.gif) | Dr. Daxita Dabas Senior Resident Obs & Gynae.jpeg | 2025-09-10 09:47 | 85K | |
![[IMG]](/icons/image2.gif) | Dr. Dharam Dev Golani Professor General Medicine.jpeg | 2025-09-10 09:47 | 81K | |
![[IMG]](/icons/image2.gif) | Dr. Dinesh Kumar Yadav Assistant Professor Pharmacology.jpeg | 2025-09-10 09:47 | 67K | |
![[IMG]](/icons/image2.gif) | Dr. Himani Tiwari Senior Resident Physiology.jpeg | 2025-09-10 09:47 | 138K | |
![[IMG]](/icons/image2.gif) | Dr. Jasbir Dalal Assistant Professor Pharmacology.jpeg | 2025-09-10 09:47 | 57K | |
![[IMG]](/icons/image2.gif) | Dr. Meenakshi Verma Assistant Professor Anaesthesiology.jpeg | 2025-09-10 09:47 | 82K | |
![[IMG]](/icons/image2.gif) | Dr. Muskan Makkar Senior Resident Psychiatry.jpeg | 2025-09-10 09:47 | 71K | |
![[IMG]](/icons/image2.gif) | Dr. Nikhil Sharma Senior Resident Orthopaedics.jpeg | 2025-09-10 09:47 | 448K | |
![[IMG]](/icons/image2.gif) | Dr. Pranav Batra Senior REsident General Surgery.jpeg | 2025-09-10 09:47 | 88K | |
![[IMG]](/icons/image2.gif) | Dr. Rama Anand Professor Radio Diagnosis.jpeg | 2025-09-10 09:47 | 122K | |
![[IMG]](/icons/image2.gif) | Dr. Shanu Maheshwari Assistant Professor Anaesthesiology.jpeg | 2025-09-10 09:47 | 65K | |
![[IMG]](/icons/image2.gif) | Dr. Venika Yadav Senior Resident Pathology.jpeg | 2025-09-10 09:47 | 54K | |
|